فهرست نشریات علمی دسترسی آزاد ایران

Sulfonated ethylenediamine supported on silica-coated magnetite nanoparticles, Fe3O4@SiO2@(CH2)3-en-SO3H/H2SO4 as a new efficient solid acid catalyst was synthesized and fully characterized using various techniques such as FT-IR, FESEM, EDS, TEM, TGA, XRD and VSM. The resulting nanostructure catalyst was applied in the green synthesis of benzimidazole derivatives by the cyclocondensation reaction of o-phenylendiamine with aromatic aldehydes in refluxed ethanol and under solvent-free conditions. The nanocatalyst can be recovered magnetically and can be reused several times without a considerable loss in its catalytic activity.